C22H17F3N4O5 — CID 11248488
N-methyl-4-[3-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]phenoxy]pyridine-2-carboxamide (PubChem CID 11248488) has the molecular formula C22H17F3N4O5 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-methyl-4-[3-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[3-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11248488 |
| Molecular Formula | C22H17F3N4O5 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-methyl-4-[3-[[[3-(trifluoromethoxy)benzoyl]amino]carbamoyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(C(=O)NNC(=O)c3cccc(OC(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C22H17F3N4O5/c1-26-21(32)18-12-16(8-9-27-18)33-15-6-2-4-13(10-15)19(30)28-29-20(31)14-5-3-7-17(11-14)34-22(23,24)25/h2-12H,1H3,(H,26,32)(H,28,30)(H,29,31) |
| InChIKey | DUVYKFGKFCQBOZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|