C21H18ClN3O4 — CID 11429828
4-[3-[(5-chloro-2-methoxyphenyl)carbamoyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 11429828) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is 4-[3-[(5-chloro-2-methoxyphenyl)carbamoyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[(5-chloro-2-methoxyphenyl)carbamoyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 11429828 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-[3-[(5-chloro-2-methoxyphenyl)carbamoyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2cccc(C(=O)Nc3cc(Cl)ccc3OC)c2)ccn1 |
| InChI | InChI=1S/C21H18ClN3O4/c1-23-21(27)18-12-16(8-9-24-18)29-15-5-3-4-13(10-15)20(26)25-17-11-14(22)6-7-19(17)28-2/h3-12H,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | INEMBPZZDFTMRO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |