C22H20N4O5 — CID 11339157
N'-(2-methoxyphenyl)-N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]oxamide (PubChem CID 11339157) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]oxamide.
| Compound Name | N'-(2-methoxyphenyl)-N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]oxamide |
|---|---|
| PubChem CID | 11339157 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N'-(2-methoxyphenyl)-N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]oxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)C(=O)Nc3ccccc3OC)cc2)ccn1 |
| InChI | InChI=1S/C22H20N4O5/c1-23-20(27)18-13-16(11-12-24-18)31-15-9-7-14(8-10-15)25-21(28)22(29)26-17-5-3-4-6-19(17)30-2/h3-13H,1-2H3,(H,23,27)(H,25,28)(H,26,29) |
| InChIKey | RJDSUNDNEXQYGR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|