C21H20ClN5O4 — CID 11224505
4-[4-[2-[(5-chloro-2-methoxyphenyl)carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 11224505) has the molecular formula C21H20ClN5O4 and a molecular weight of 441.88 g/mol. Its IUPAC name is 4-[4-[2-[(5-chloro-2-methoxyphenyl)carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[2-[(5-chloro-2-methoxyphenyl)carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 11224505 |
| Molecular Formula | C21H20ClN5O4 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[4-[2-[(5-chloro-2-methoxyphenyl)carbamoyl]hydrazinyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NNC(=O)Nc3cc(Cl)ccc3OC)cc2)ccn1 |
| InChI | InChI=1S/C21H20ClN5O4/c1-23-20(28)18-12-16(9-10-24-18)31-15-6-4-14(5-7-15)26-27-21(29)25-17-11-13(22)3-8-19(17)30-2/h3-12,26H,1-2H3,(H,23,28)(H2,25,27,29) |
| InChIKey | QFVHBFKQNYWJDE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|