C40H37N5O5 — CID 162196336
2-methoxy-5-phenylaniline;4-[4-[(2-methoxy-5-phenylphenyl)carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 162196336) has the molecular formula C40H37N5O5 and a molecular weight of 667.77 g/mol. Its IUPAC name is 2-methoxy-5-phenylaniline;4-[4-[(2-methoxy-5-phenylphenyl)carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 2-methoxy-5-phenylaniline;4-[4-[(2-methoxy-5-phenylphenyl)carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 162196336 |
| Molecular Formula | C40H37N5O5 |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 2-methoxy-5-phenylaniline;4-[4-[(2-methoxy-5-phenylphenyl)carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cc(-c4ccccc4)ccc3OC)cc2)ccn1.COc1ccc(-c2ccccc2)cc1N |
| InChI | InChI=1S/C27H24N4O4.C13H13NO/c1-28-26(32)24-17-22(14-15-29-24)35-21-11-9-20(10-12-21)30-27(33)31-23-16-19(8-13-25(23)34-2)18-6-4-3-5-7-18;1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10/h3-17H,1-2H3,(H,28,32)(H2,30,31,33);2-9H,14H2,1H3 |
| InChIKey | ZQZHTPGFJQTABE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|