C24H26IN5O4 — CID 89346413
4-[4-[[2-(2-aminoethoxy)-4-(iodomethyl)-5-methylphenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 89346413) has the molecular formula C24H26IN5O4 and a molecular weight of 575.41 g/mol. Its IUPAC name is 4-[4-[[2-(2-aminoethoxy)-4-(iodomethyl)-5-methylphenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-(2-aminoethoxy)-4-(iodomethyl)-5-methylphenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 89346413 |
| Molecular Formula | C24H26IN5O4 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 4-[4-[[2-(2-aminoethoxy)-4-(iodomethyl)-5-methylphenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3cc(C)c(CI)cc3OCCN)cc2)ccn1 |
| InChI | InChI=1S/C24H26IN5O4/c1-15-11-20(22(33-10-8-26)12-16(15)14-25)30-24(32)29-17-3-5-18(6-4-17)34-19-7-9-28-21(13-19)23(31)27-2/h3-7,9,11-13H,8,10,14,26H2,1-2H3,(H,27,31)(H2,29,30,32) |
| InChIKey | LFEUTJLXUCDZQO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|