C21H20N4O2S — CID 141473965
N-methyl-4-[4-[(4-methylphenyl)carbamothioylamino]phenoxy]pyridine-2-carboxamide (PubChem CID 141473965) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-methyl-4-[4-[(4-methylphenyl)carbamothioylamino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[(4-methylphenyl)carbamothioylamino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141473965 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-methyl-4-[4-[(4-methylphenyl)carbamothioylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=S)Nc3ccc(C)cc3)cc2)ccn1 |
| InChI | InChI=1S/C21H20N4O2S/c1-14-3-5-15(6-4-14)24-21(28)25-16-7-9-17(10-8-16)27-18-11-12-23-19(13-18)20(26)22-2/h3-13H,1-2H3,(H,22,26)(H2,24,25,28) |
| InChIKey | BLFYZMMWYZNCNR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|