C21H20ClN5O2S — CID 89041396
4-[3-amino-4-[(4-chloro-3-methylphenyl)carbamothioylamino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 89041396) has the molecular formula C21H20ClN5O2S and a molecular weight of 441.94 g/mol. Its IUPAC name is 4-[3-amino-4-[(4-chloro-3-methylphenyl)carbamothioylamino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-amino-4-[(4-chloro-3-methylphenyl)carbamothioylamino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 89041396 |
| Molecular Formula | C21H20ClN5O2S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-[3-amino-4-[(4-chloro-3-methylphenyl)carbamothioylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=S)Nc3ccc(Cl)c(C)c3)c(N)c2)ccn1 |
| InChI | InChI=1S/C21H20ClN5O2S/c1-12-9-13(3-5-16(12)22)26-21(30)27-18-6-4-14(10-17(18)23)29-15-7-8-25-19(11-15)20(28)24-2/h3-11H,23H2,1-2H3,(H,24,28)(H2,26,27,30) |
| InChIKey | TWIQKNUZRLIEIT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|