C21H18ClN3O4 — CID 71248936
methyl 4-[4-[(4-chloro-3-methylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate (PubChem CID 71248936) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is methyl 4-[4-[(4-chloro-3-methylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[(4-chloro-3-methylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71248936 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | methyl 4-[4-[(4-chloro-3-methylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C)c3)cc2)ccn1 |
| InChI | InChI=1S/C21H18ClN3O4/c1-13-11-15(5-8-18(13)22)25-21(27)24-14-3-6-16(7-4-14)29-17-9-10-23-19(12-17)20(26)28-2/h3-12H,1-2H3,(H2,24,25,27) |
| InChIKey | VJGINCXJEVWPQC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |