C21H16ClF3N4O4 — CID 91398300
4-[4-[(4-chloro-3-methylphenoxy)carbamoylamino]phenoxy]-N-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 91398300) has the molecular formula C21H16ClF3N4O4 and a molecular weight of 480.83 g/mol. Its IUPAC name is 4-[4-[(4-chloro-3-methylphenoxy)carbamoylamino]phenoxy]-N-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 4-[4-[(4-chloro-3-methylphenoxy)carbamoylamino]phenoxy]-N-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91398300 |
| Molecular Formula | C21H16ClF3N4O4 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4-[4-[(4-chloro-3-methylphenoxy)carbamoylamino]phenoxy]-N-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(ONC(=O)Nc2ccc(Oc3ccnc(C(=O)NC(F)(F)F)c3)cc2)ccc1Cl |
| InChI | InChI=1S/C21H16ClF3N4O4/c1-12-10-16(6-7-17(12)22)33-29-20(31)27-13-2-4-14(5-3-13)32-15-8-9-26-18(11-15)19(30)28-21(23,24)25/h2-11H,1H3,(H,28,30)(H2,27,29,31) |
| InChIKey | SNKQJNZAEFRXNT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|