C23H22N4O4S — CID 46843010
ethyl 3-[[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamothioylamino]benzoate (PubChem CID 46843010) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is ethyl 3-[[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 3-[[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 46843010 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | ethyl 3-[[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)Nc2ccc(Oc3ccnc(C(=O)NC)c3)cc2)c1 |
| InChI | InChI=1S/C23H22N4O4S/c1-3-30-22(29)15-5-4-6-17(13-15)27-23(32)26-16-7-9-18(10-8-16)31-19-11-12-25-20(14-19)21(28)24-2/h4-14H,3H2,1-2H3,(H,24,28)(H2,26,27,32) |
| InChIKey | PRLWWXKJPYIKCJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|