C23H22N4O5 — CID 142886643
ethyl 3-[[4-[(2-carbamoyl-4-pyridinyl)oxy]phenyl]methylcarbamoylamino]benzoate (PubChem CID 142886643) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 3-[[4-[(2-carbamoyl-4-pyridinyl)oxy]phenyl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[[4-[(2-carbamoyl-4-pyridinyl)oxy]phenyl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 142886643 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | ethyl 3-[[4-[(2-carbamoyl-4-pyridinyl)oxy]phenyl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NCc2ccc(Oc3ccnc(C(N)=O)c3)cc2)c1 |
| InChI | InChI=1S/C23H22N4O5/c1-2-31-22(29)16-4-3-5-17(12-16)27-23(30)26-14-15-6-8-18(9-7-15)32-19-10-11-25-20(13-19)21(24)28/h3-13H,2,14H2,1H3,(H2,24,28)(H2,26,27,30) |
| InChIKey | RTBJPKAEGILPAG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |