C22H19F3N4O4S — CID 142886664
N-methyl-4-[4-[[[3-(trifluoromethylsulfanyloxy)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxamide (PubChem CID 142886664) has the molecular formula C22H19F3N4O4S and a molecular weight of 492.48 g/mol. Its IUPAC name is N-methyl-4-[4-[[[3-(trifluoromethylsulfanyloxy)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[4-[[[3-(trifluoromethylsulfanyloxy)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142886664 |
| Molecular Formula | C22H19F3N4O4S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-methyl-4-[4-[[[3-(trifluoromethylsulfanyloxy)phenyl]carbamoylamino]methyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(CNC(=O)Nc3cccc(OSC(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C22H19F3N4O4S/c1-26-20(30)19-12-17(9-10-27-19)32-16-7-5-14(6-8-16)13-28-21(31)29-15-3-2-4-18(11-15)33-34-22(23,24)25/h2-12H,13H2,1H3,(H,26,30)(H2,28,29,31) |
| InChIKey | ZGTSWFWJURJKDF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|