C20H16ClN3O5 — CID 91524506
[4-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]phenoxy]-2-pyridinyl] N-methylcarbamate (PubChem CID 91524506) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is [4-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]phenoxy]-2-pyridinyl] N-methylcarbamate.
| Compound Name | [4-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]phenoxy]-2-pyridinyl] N-methylcarbamate |
|---|---|
| PubChem CID | 91524506 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [4-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]phenoxy]-2-pyridinyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(Oc2cccc(C(=O)Nc3ccc(Cl)cc3O)c2)ccn1 |
| InChI | InChI=1S/C20H16ClN3O5/c1-22-20(27)29-18-11-15(7-8-23-18)28-14-4-2-3-12(9-14)19(26)24-16-6-5-13(21)10-17(16)25/h2-11,25H,1H3,(H,22,27)(H,24,26) |
| InChIKey | CYCIZHWCVABGRZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|