C17H17Cl2NO2 — CID 17149678
3-butan-2-yloxy-N-(2,4-dichlorophenyl)benzamide (PubChem CID 17149678) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-(2,4-dichlorophenyl)benzamide.
| Compound Name | 3-butan-2-yloxy-N-(2,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 17149678 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-butan-2-yloxy-N-(2,4-dichlorophenyl)benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-3-11(2)22-14-6-4-5-12(9-14)17(21)20-16-8-7-13(18)10-15(16)19/h4-11H,3H2,1-2H3,(H,20,21) |
| InChIKey | QPWOYISTUFGCKC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |