C18H19ClN2O3 — CID 40614005
3-[(2S)-butan-2-yl]oxy-N'-(4-chlorobenzoyl)benzohydrazide (PubChem CID 40614005) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]oxy-N'-(4-chlorobenzoyl)benzohydrazide.
| Compound Name | 3-[(2S)-butan-2-yl]oxy-N'-(4-chlorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 40614005 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[(2S)-butan-2-yl]oxy-N'-(4-chlorobenzoyl)benzohydrazide |
| SMILES | CC[C@H](C)Oc1cccc(C(=O)NNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-3-12(2)24-16-6-4-5-14(11-16)18(23)21-20-17(22)13-7-9-15(19)10-8-13/h4-12H,3H2,1-2H3,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | OPSDYHGUHOGZRK-LBPRGKRZSA-N |
| XLogP | 3.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|