C27H29N3O3 — CID 143262898
4-[3-[(E)-3-(3-butylanilino)-2-methyl-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 143262898) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[3-[(E)-3-(3-butylanilino)-2-methyl-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[3-[(E)-3-(3-butylanilino)-2-methyl-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143262898 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-[3-[(E)-3-(3-butylanilino)-2-methyl-3-oxoprop-1-enyl]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CCCCc1cccc(NC(=O)/C(C)=C/c2cccc(Oc3ccnc(C(=O)NC)c3)c2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-4-5-8-20-9-6-11-22(16-20)30-26(31)19(2)15-21-10-7-12-23(17-21)33-24-13-14-29-25(18-24)27(32)28-3/h6-7,9-18H,4-5,8H2,1-3H3,(H,28,32)(H,30,31)/b19-15+ |
| InChIKey | UBVQTTJTSNYGTA-XDJHFCHBSA-N |
| XLogP | 5.62 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|