C24H16F3N5O4 — CID 58674300
5-[4-[3-[(E)-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]-2-pyridinyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 58674300) has the molecular formula C24H16F3N5O4 and a molecular weight of 495.42 g/mol. Its IUPAC name is 5-[4-[3-[(E)-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]-2-pyridinyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[4-[3-[(E)-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]-2-pyridinyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 58674300 |
| Molecular Formula | C24H16F3N5O4 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 5-[4-[3-[(E)-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]phenoxy]-2-pyridinyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | NC(=O)c1nnc(-c2cc(Oc3cccc(/C=C/C(=O)Nc4cccc(C(F)(F)F)c4)c3)ccn2)o1 |
| InChI | InChI=1S/C24H16F3N5O4/c25-24(26,27)15-4-2-5-16(12-15)30-20(33)8-7-14-3-1-6-17(11-14)35-18-9-10-29-19(13-18)22-31-32-23(36-22)21(28)34/h1-13H,(H2,28,34)(H,30,33)/b8-7+ |
| InChIKey | XLBACSCMSXDGBY-BQYQJAHWSA-N |
| XLogP | 4.69 |
| TPSA | 133.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|