C23H20N6O2 — CID 58674607
(E)-N-(3-ethylphenyl)-3-[3-[[2-(2H-tetrazol-5-yl)-4-pyridinyl]oxy]phenyl]prop-2-enamide (PubChem CID 58674607) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is (E)-N-(3-ethylphenyl)-3-[3-[[2-(2H-tetrazol-5-yl)-4-pyridinyl]oxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-ethylphenyl)-3-[3-[[2-(2H-tetrazol-5-yl)-4-pyridinyl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58674607 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (E)-N-(3-ethylphenyl)-3-[3-[[2-(2H-tetrazol-5-yl)-4-pyridinyl]oxy]phenyl]prop-2-enamide |
| SMILES | CCc1cccc(NC(=O)/C=C/c2cccc(Oc3ccnc(-c4nn[nH]n4)c3)c2)c1 |
| InChI | InChI=1S/C23H20N6O2/c1-2-16-5-3-7-18(13-16)25-22(30)10-9-17-6-4-8-19(14-17)31-20-11-12-24-21(15-20)23-26-28-29-27-23/h3-15H,2H2,1H3,(H,25,30)(H,26,27,28,29)/b10-9+ |
| InChIKey | JQPKWRLOPNPNGO-MDZDMXLPSA-N |
| XLogP | 4.27 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|