C24H22N4O2S — CID 58674534
(E)-3-[3-[[2-(4,5-dihydro-1H-imidazol-2-yl)-4-pyridinyl]oxy]phenyl]-N-(3-methylsulfanylphenyl)prop-2-enamide (PubChem CID 58674534) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is (E)-3-[3-[[2-(4,5-dihydro-1H-imidazol-2-yl)-4-pyridinyl]oxy]phenyl]-N-(3-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[[2-(4,5-dihydro-1H-imidazol-2-yl)-4-pyridinyl]oxy]phenyl]-N-(3-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 58674534 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (E)-3-[3-[[2-(4,5-dihydro-1H-imidazol-2-yl)-4-pyridinyl]oxy]phenyl]-N-(3-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1cccc(NC(=O)/C=C/c2cccc(Oc3ccnc(C4=NCCN4)c3)c2)c1 |
| InChI | InChI=1S/C24H22N4O2S/c1-31-21-7-3-5-18(15-21)28-23(29)9-8-17-4-2-6-19(14-17)30-20-10-11-25-22(16-20)24-26-12-13-27-24/h2-11,14-16H,12-13H2,1H3,(H,26,27)(H,28,29)/b9-8+ |
| InChIKey | HOBADHCASXVAGW-CMDGGOBGSA-N |
| XLogP | 4.60 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|