C28H21F3N4O2 — CID 155125539
3-[(E)-3-[3-(2-methylpyrimidin-4-yl)anilino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 155125539) has the molecular formula C28H21F3N4O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is 3-[(E)-3-[3-(2-methylpyrimidin-4-yl)anilino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(E)-3-[3-(2-methylpyrimidin-4-yl)anilino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155125539 |
| Molecular Formula | C28H21F3N4O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 3-[(E)-3-[3-(2-methylpyrimidin-4-yl)anilino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1nccc(-c2cccc(NC(=O)/C=C/c3cccc(C(=O)Nc4cccc(C(F)(F)F)c4)c3)c2)n1 |
| InChI | InChI=1S/C28H21F3N4O2/c1-18-32-14-13-25(33-18)20-6-3-9-23(16-20)34-26(36)12-11-19-5-2-7-21(15-19)27(37)35-24-10-4-8-22(17-24)28(29,30)31/h2-17H,1H3,(H,34,36)(H,35,37)/b12-11+ |
| InChIKey | ZMESVXYIJZPSTL-VAWYXSNFSA-N |
| XLogP | 6.38 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|