C23H17F3N2O3 — CID 155125735
3-[3-(2-hydroxyanilino)-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 155125735) has the molecular formula C23H17F3N2O3 and a molecular weight of 426.39 g/mol. Its IUPAC name is 3-[3-(2-hydroxyanilino)-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[3-(2-hydroxyanilino)-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155125735 |
| Molecular Formula | C23H17F3N2O3 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3-[3-(2-hydroxyanilino)-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(C=Cc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1ccccc1O |
| InChI | InChI=1S/C23H17F3N2O3/c24-23(25,26)17-7-4-8-18(14-17)27-22(31)16-6-3-5-15(13-16)11-12-21(30)28-19-9-1-2-10-20(19)29/h1-14,29H,(H,27,31)(H,28,30) |
| InChIKey | OBACSGXUXLCFES-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|