C28H20Cl2F3N5O4 — CID 86567237
1-[4-[[2-[[[2-(2-chlorophenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 86567237) has the molecular formula C28H20Cl2F3N5O4 and a molecular weight of 618.40 g/mol. Its IUPAC name is 1-[4-[[2-[[[2-(2-chlorophenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[[2-[[[2-(2-chlorophenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 86567237 |
| Molecular Formula | C28H20Cl2F3N5O4 |
| Molecular Weight | 618.40 g/mol |
| Exact Mass | 617.08 |
| IUPAC Name | 1-[4-[[2-[[[2-(2-chlorophenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Cc1ccccc1Cl)NNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C28H20Cl2F3N5O4/c29-22-4-2-1-3-16(22)13-25(39)37-38-26(40)24-15-20(11-12-34-24)42-19-8-5-17(6-9-19)35-27(41)36-18-7-10-23(30)21(14-18)28(31,32)33/h1-12,14-15H,13H2,(H,37,39)(H,38,40)(H2,35,36,41) |
| InChIKey | PARJCXSURIYSCS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.40 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|