C30H25ClF3N5O6 — CID 86567563
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[2-(3,4-dimethoxyphenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea (PubChem CID 86567563) has the molecular formula C30H25ClF3N5O6 and a molecular weight of 644.01 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[2-(3,4-dimethoxyphenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[2-(3,4-dimethoxyphenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 86567563 |
| Molecular Formula | C30H25ClF3N5O6 |
| Molecular Weight | 644.01 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[2-(3,4-dimethoxyphenyl)acetyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)ccn2)cc1OC |
| InChI | InChI=1S/C30H25ClF3N5O6/c1-43-25-10-3-17(13-26(25)44-2)14-27(40)38-39-28(41)24-16-21(11-12-35-24)45-20-7-4-18(5-8-20)36-29(42)37-19-6-9-23(31)22(15-19)30(32,33)34/h3-13,15-16H,14H2,1-2H3,(H,38,40)(H,39,41)(H2,36,37,42) |
| InChIKey | KVHCJZGOVHPWFF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.01 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|