C18H18ClF3N2O3S — CID 33314975
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 33314975) has the molecular formula C18H18ClF3N2O3S and a molecular weight of 434.87 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 33314975 |
| Molecular Formula | C18H18ClF3N2O3S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18ClF3N2O3S/c1-11(2)24(3)28(26,27)14-7-4-12(5-8-14)17(25)23-13-6-9-16(19)15(10-13)18(20,21)22/h4-11H,1-3H3,(H,23,25) |
| InChIKey | HGLKKGAAJKJSEZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |