C42H44N4O11P2 — CID 88523038
CID 88523038 (PubChem CID 88523038) has the molecular formula C42H44N4O11P2 and a molecular weight of 842.78 g/mol.
| Compound Name | CID 88523038 |
|---|---|
| PubChem CID | 88523038 |
| Molecular Formula | C42H44N4O11P2 |
| Molecular Weight | 842.78 g/mol |
| Exact Mass | 842.25 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc3c(c2)N(C(C)(C)P(=O)=O)C(=O)C3(C)C)cc1.CC1(C)C(=O)N(C(C)(C)P(=O)=O)c2cc(NC(=O)c3ccc(O)cc3)ccc21 |
| InChI | InChI=1S/C22H23N2O6P.C20H21N2O5P/c1-13(25)30-16-9-6-14(7-10-16)19(26)23-15-8-11-17-18(12-15)24(20(27)21(17,2)3)22(4,5)31(28)29;1-19(2)15-10-7-13(21-17(24)12-5-8-14(23)9-6-12)11-16(15)22(18(19)25)20(3,4)28(26)27/h6-12H,1-5H3,(H,23,26);5-11,23H,1-4H3,(H,21,24) |
| InChIKey | LIFUSJAYAWHTAS-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 213.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.78 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|