C21H25NO3 — CID 166326596
N-(2,4-dihydroxyphenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide (PubChem CID 166326596) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(2,4-dihydroxyphenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(2,4-dihydroxyphenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 166326596 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-(2,4-dihydroxyphenyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)Nc3ccc(O)cc3O)ccc21 |
| InChI | InChI=1S/C21H25NO3/c1-20(2)9-10-21(3,4)16-11-13(5-7-15(16)20)19(25)22-17-8-6-14(23)12-18(17)24/h5-8,11-12,23-24H,9-10H2,1-4H3,(H,22,25) |
| InChIKey | NYTZPMYAODQFTQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|