C24H28FNO4 — CID 15463178
ethyl 2-fluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate (PubChem CID 15463178) has the molecular formula C24H28FNO4 and a molecular weight of 413.49 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate.
| Compound Name | ethyl 2-fluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 15463178 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 2-fluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)Nc2cc3c(cc2O)C(C)(C)CCC3(C)C)cc1F |
| InChI | InChI=1S/C24H28FNO4/c1-6-30-22(29)15-8-7-14(11-18(15)25)21(28)26-19-12-16-17(13-20(19)27)24(4,5)10-9-23(16,2)3/h7-8,11-13,27H,6,9-10H2,1-5H3,(H,26,28) |
| InChIKey | IPVMYNQDTDDNGK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|