C19H19NO3 — CID 17492553
ethyl 2-(2,3-dihydro-1H-indene-5-carbonylamino)benzoate (PubChem CID 17492553) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1H-indene-5-carbonylamino)benzoate.
| Compound Name | ethyl 2-(2,3-dihydro-1H-indene-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 17492553 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1H-indene-5-carbonylamino)benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H19NO3/c1-2-23-19(22)16-8-3-4-9-17(16)20-18(21)15-11-10-13-6-5-7-14(13)12-15/h3-4,8-12H,2,5-7H2,1H3,(H,20,21) |
| InChIKey | FPIJLGOKIQYPAD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |