C25H24N2O2 — CID 100703574
N-[2-(benzylcarbamoyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 100703574) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[2-(benzylcarbamoyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[2-(benzylcarbamoyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 100703574 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[2-(benzylcarbamoyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C25H24N2O2/c28-24(21-15-14-19-10-4-5-11-20(19)16-21)27-23-13-7-6-12-22(23)25(29)26-17-18-8-2-1-3-9-18/h1-3,6-9,12-16H,4-5,10-11,17H2,(H,26,29)(H,27,28) |
| InChIKey | DPIFSZPIYVYULQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |