C26H20N2O4 — CID 90656007
4-[[[2-(naphthalene-2-carbonylamino)benzoyl]amino]methyl]benzoic acid (PubChem CID 90656007) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-[[[2-(naphthalene-2-carbonylamino)benzoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(naphthalene-2-carbonylamino)benzoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 90656007 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-[[[2-(naphthalene-2-carbonylamino)benzoyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccccc2NC(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H20N2O4/c29-24(21-14-13-18-5-1-2-6-20(18)15-21)28-23-8-4-3-7-22(23)25(30)27-16-17-9-11-19(12-10-17)26(31)32/h1-15H,16H2,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | DVSVBYUORBALIL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |