C29H22N2O3 — CID 22081973
7-N-benzyl-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide (PubChem CID 22081973) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 7-N-benzyl-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide.
| Compound Name | 7-N-benzyl-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 22081973 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 7-N-benzyl-3-hydroxy-2-N-naphthalen-1-ylnaphthalene-2,7-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2cc(O)c(C(=O)Nc3cccc4ccccc34)cc2c1 |
| InChI | InChI=1S/C29H22N2O3/c32-27-17-21-13-14-22(28(33)30-18-19-7-2-1-3-8-19)15-23(21)16-25(27)29(34)31-26-12-6-10-20-9-4-5-11-24(20)26/h1-17,32H,18H2,(H,30,33)(H,31,34) |
| InChIKey | UGFLVFPTADWKNG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |