C13H11NO4 — CID 171363826
N-(2,4-dihydroxyphenyl)-4-hydroxybenzamide (PubChem CID 171363826) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is N-(2,4-dihydroxyphenyl)-4-hydroxybenzamide.
| Compound Name | N-(2,4-dihydroxyphenyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 171363826 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(2,4-dihydroxyphenyl)-4-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(O)cc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H11NO4/c15-9-3-1-8(2-4-9)13(18)14-11-6-5-10(16)7-12(11)17/h1-7,15-17H,(H,14,18) |
| InChIKey | DAVDCGKWJNFVLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|