C33H39NO2 — CID 70455322
(4-aminophenyl) 4-[2-(6-butyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate (PubChem CID 70455322) has the molecular formula C33H39NO2 and a molecular weight of 481.68 g/mol. Its IUPAC name is (4-aminophenyl) 4-[2-(6-butyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate.
| Compound Name | (4-aminophenyl) 4-[2-(6-butyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 70455322 |
| Molecular Formula | C33H39NO2 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | (4-aminophenyl) 4-[2-(6-butyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
| SMILES | CCCCc1cc2c(cc1C(C)=Cc1ccc(C(=O)Oc3ccc(N)cc3)cc1)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C33H39NO2/c1-7-8-9-25-19-29-30(33(5,6)21-32(29,3)4)20-28(25)22(2)18-23-10-12-24(13-11-23)31(35)36-27-16-14-26(34)15-17-27/h10-20H,7-9,21,34H2,1-6H3 |
| InChIKey | DINRZANPOUZAOB-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|