C31H42O2 — CID 54355486
butyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate (PubChem CID 54355486) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is butyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate.
| Compound Name | butyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54355486 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | butyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(C=C(C)c2cc3c(cc2CC(C)C)C(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C31H42O2/c1-9-10-15-33-29(32)24-13-11-23(12-14-24)17-22(4)26-19-28-27(18-25(26)16-21(2)3)30(5,6)20-31(28,7)8/h11-14,17-19,21H,9-10,15-16,20H2,1-8H3 |
| InChIKey | UIUWQYNEZLKKLI-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|