C23H26O2 — CID 69396200
4-[(Z)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid (PubChem CID 69396200) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[(Z)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 69396200 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[(Z)-2-(1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C/c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C23H26O2/c1-15(12-16-6-8-17(9-7-16)21(24)25)18-10-11-19-20(13-18)23(4,5)14-22(19,2)3/h6-13H,14H2,1-5H3,(H,24,25)/b15-12- |
| InChIKey | FUCBJLFYALIAEU-QINSGFPZSA-N |
| XLogP | 5.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|