C22H24O2S — CID 54058439
4-[2-(3,3-dimethyl-4,5-dihydro-2H-1-benzothiepin-8-yl)prop-1-enyl]benzoic acid (PubChem CID 54058439) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-[2-(3,3-dimethyl-4,5-dihydro-2H-1-benzothiepin-8-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[2-(3,3-dimethyl-4,5-dihydro-2H-1-benzothiepin-8-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54058439 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[2-(3,3-dimethyl-4,5-dihydro-2H-1-benzothiepin-8-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(=Cc1ccc(C(=O)O)cc1)c1ccc2c(c1)SCC(C)(C)CC2 |
| InChI | InChI=1S/C22H24O2S/c1-15(12-16-4-6-18(7-5-16)21(23)24)19-9-8-17-10-11-22(2,3)14-25-20(17)13-19/h4-9,12-13H,10-11,14H2,1-3H3,(H,23,24) |
| InChIKey | LXXZGFHKACXTIP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|