C21H22O3S2 — CID 67734780
4-[2-(4,4-dimethyl-1-sulfinyl-2,3-dihydrothiochromen-7-yl)prop-1-enyl]benzoic acid (PubChem CID 67734780) has the molecular formula C21H22O3S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-[2-(4,4-dimethyl-1-sulfinyl-2,3-dihydrothiochromen-7-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[2-(4,4-dimethyl-1-sulfinyl-2,3-dihydrothiochromen-7-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 67734780 |
| Molecular Formula | C21H22O3S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-[2-(4,4-dimethyl-1-sulfinyl-2,3-dihydrothiochromen-7-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(=Cc1ccc(C(=O)O)cc1)c1ccc2c(c1)S(=S=O)CCC2(C)C |
| InChI | InChI=1S/C21H22O3S2/c1-14(12-15-4-6-16(7-5-15)20(22)23)17-8-9-18-19(13-17)26(25-24)11-10-21(18,2)3/h4-9,12-13H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | QTTYWKORAUNDTH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|