C22H24O2S — CID 18646291
4-[(E)-2-(5,5-dimethyl-3,4-dihydro-2H-1-benzothiepin-7-yl)prop-1-enyl]benzoic acid (PubChem CID 18646291) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-[(E)-2-(5,5-dimethyl-3,4-dihydro-2H-1-benzothiepin-7-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-2-(5,5-dimethyl-3,4-dihydro-2H-1-benzothiepin-7-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 18646291 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[(E)-2-(5,5-dimethyl-3,4-dihydro-2H-1-benzothiepin-7-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCCS2 |
| InChI | InChI=1S/C22H24O2S/c1-15(13-16-5-7-17(8-6-16)21(23)24)18-9-10-20-19(14-18)22(2,3)11-4-12-25-20/h5-10,13-14H,4,11-12H2,1-3H3,(H,23,24)/b15-13+ |
| InChIKey | IAFZZKIAJUOFJE-FYWRMAATSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|