C22H21F3O2S — CID 14776671
methyl 4-[(E)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoate (PubChem CID 14776671) has the molecular formula C22H21F3O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is methyl 4-[(E)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 14776671 |
| Molecular Formula | C22H21F3O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | methyl 4-[(E)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-3,3,3-trifluoroprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\c2ccc3c(c2)C(C)(C)CCS3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F3O2S/c1-21(2)10-11-28-19-9-8-16(13-18(19)21)17(22(23,24)25)12-14-4-6-15(7-5-14)20(26)27-3/h4-9,12-13H,10-11H2,1-3H3/b17-12+ |
| InChIKey | VZCDXXSDZFFCJF-SFQUDFHCSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|