C24H25F3O2S — CID 14776665
methyl 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate (PubChem CID 14776665) has the molecular formula C24H25F3O2S and a molecular weight of 434.52 g/mol. Its IUPAC name is methyl 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 14776665 |
| Molecular Formula | C24H25F3O2S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | methyl 4-[(Z)-3,3,3-trifluoro-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(/c2ccc3c(c2)C(C)(C)CC(C)(C)S3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F3O2S/c1-22(2)14-23(3,4)30-20-11-10-17(13-19(20)22)18(24(25,26)27)12-15-6-8-16(9-7-15)21(28)29-5/h6-13H,14H2,1-5H3/b18-12- |
| InChIKey | GNGUSRAFVFGXTN-PDGQHHTCSA-N |
| XLogP | 7.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|