C20H21NO2S — CID 67760690
methyl 4-[(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)methylideneamino]benzoate (PubChem CID 67760690) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is methyl 4-[(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)methylideneamino]benzoate.
| Compound Name | methyl 4-[(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 67760690 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 4-[(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc3c(c2)C(C)(C)CCS3)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-20(2)10-11-24-18-9-4-14(12-17(18)20)13-21-16-7-5-15(6-8-16)19(22)23-3/h4-9,12-13H,10-11H2,1-3H3/b21-13+ |
| InChIKey | DRNYFNMDZYWCDG-FYJGNVAPSA-N |
| XLogP | 5.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|