About methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate
methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate (PubChem CID 160768273) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate.
Molecular Properties
| Compound Name | methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate |
| PubChem CID | 160768273 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate |
| SMILES | C.COC(=O)c1ccc(/C=N/c2ccc(C)cc2)cc1.COC=O |
| InChI | InChI=1S/C16H15NO2.C2H4O2.CH4/c1-12-3-9-15(10-4-12)17-11-13-5-7-14(8-6-13)16(18)19-2;1-4-2-3;/h3-11H,1-2H3;2H,1H3;1H4/b17-11+;; |
| InChIKey | RYYXULSUIAWKSG-HSZLIDMQSA-N |
| XLogP | 3.96 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate?
The IUPAC name of methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate (CID 160768273) is methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate.
What is the SMILES notation for methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate?
The canonical SMILES for methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate is C.COC(=O)c1ccc(/C=N/c2ccc(C)cc2)cc1.COC=O.
What is the InChIKey of methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate?
The InChIKey is RYYXULSUIAWKSG-HSZLIDMQSA-N. The full InChI is InChI=1S/C16H15NO2.C2H4O2.CH4/c1-12-3-9-15(10-4-12)17-11-13-5-7-14(8-6-13)16(18)19-2;1-4-2-3;/h3-11H,1-2H3;2H,1H3;1H4/b17-11+;;.
What are the key properties of methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate?
methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate has a molecular weight of 329.40 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl formate;methyl 4-[(4-methylphenyl)iminomethyl]benzoate is sourced from PubChem (CID 160768273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).