C26H29NO3 — CID 67591566
methyl 4-[[3-(1-adamantyl)-4-methoxyphenyl]methylideneamino]benzoate (PubChem CID 67591566) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 4-[[3-(1-adamantyl)-4-methoxyphenyl]methylideneamino]benzoate.
| Compound Name | methyl 4-[[3-(1-adamantyl)-4-methoxyphenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 67591566 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | methyl 4-[[3-(1-adamantyl)-4-methoxyphenyl]methylideneamino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc(OC)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-29-24-8-3-17(16-27-22-6-4-21(5-7-22)25(28)30-2)12-23(24)26-13-18-9-19(14-26)11-20(10-18)15-26/h3-8,12,16,18-20H,9-11,13-15H2,1-2H3/b27-16+ |
| InChIKey | IAJBZYYTQHLEQS-JVWAILMASA-N |
| XLogP | 5.70 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|