C33H32O3 — CID 19063027
methyl 4-[2-[3-(1-adamantyl)-4-phenylmethoxyphenyl]ethynyl]benzoate (PubChem CID 19063027) has the molecular formula C33H32O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is methyl 4-[2-[3-(1-adamantyl)-4-phenylmethoxyphenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[3-(1-adamantyl)-4-phenylmethoxyphenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 19063027 |
| Molecular Formula | C33H32O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl 4-[2-[3-(1-adamantyl)-4-phenylmethoxyphenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C33H32O3/c1-35-32(34)29-12-9-23(10-13-29)7-8-24-11-14-31(36-22-25-5-3-2-4-6-25)30(18-24)33-19-26-15-27(20-33)17-28(16-26)21-33/h2-6,9-14,18,26-28H,15-17,19-22H2,1H3 |
| InChIKey | HECIMYVRXZQSMN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|