C34H36O4S — CID 23577140
ethyl 4-[3-(1-adamantyl)-4-phenylmethoxybenzoyl]sulfanyl-3-methylbenzoate (PubChem CID 23577140) has the molecular formula C34H36O4S and a molecular weight of 540.73 g/mol. Its IUPAC name is ethyl 4-[3-(1-adamantyl)-4-phenylmethoxybenzoyl]sulfanyl-3-methylbenzoate.
| Compound Name | ethyl 4-[3-(1-adamantyl)-4-phenylmethoxybenzoyl]sulfanyl-3-methylbenzoate |
|---|---|
| PubChem CID | 23577140 |
| Molecular Formula | C34H36O4S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | ethyl 4-[3-(1-adamantyl)-4-phenylmethoxybenzoyl]sulfanyl-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(SC(=O)c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c(C)c1 |
| InChI | InChI=1S/C34H36O4S/c1-3-37-32(35)27-10-12-31(22(2)13-27)39-33(36)28-9-11-30(38-21-23-7-5-4-6-8-23)29(17-28)34-18-24-14-25(19-34)16-26(15-24)20-34/h4-13,17,24-26H,3,14-16,18-21H2,1-2H3 |
| InChIKey | ADMLFXPJHSCLTK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|