C37H36O5 — CID 19429712
benzyl 6-[3-(1-adamantyl)-4-(2-methoxy-2-oxoethoxy)phenyl]naphthalene-2-carboxylate (PubChem CID 19429712) has the molecular formula C37H36O5 and a molecular weight of 560.69 g/mol. Its IUPAC name is benzyl 6-[3-(1-adamantyl)-4-(2-methoxy-2-oxoethoxy)phenyl]naphthalene-2-carboxylate.
| Compound Name | benzyl 6-[3-(1-adamantyl)-4-(2-methoxy-2-oxoethoxy)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 19429712 |
| Molecular Formula | C37H36O5 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | benzyl 6-[3-(1-adamantyl)-4-(2-methoxy-2-oxoethoxy)phenyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)COc1ccc(-c2ccc3cc(C(=O)OCc4ccccc4)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C37H36O5/c1-40-35(38)23-41-34-12-11-31(18-33(34)37-19-25-13-26(20-37)15-27(14-25)21-37)29-7-8-30-17-32(10-9-28(30)16-29)36(39)42-22-24-5-3-2-4-6-24/h2-12,16-18,25-27H,13-15,19-23H2,1H3 |
| InChIKey | NLLMQVMJOWOIDM-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |