C39H40O4 — CID 19429711
benzyl 6-[4-(3-acetyloxypropyl)-3-(1-adamantyl)phenyl]naphthalene-2-carboxylate (PubChem CID 19429711) has the molecular formula C39H40O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is benzyl 6-[4-(3-acetyloxypropyl)-3-(1-adamantyl)phenyl]naphthalene-2-carboxylate.
| Compound Name | benzyl 6-[4-(3-acetyloxypropyl)-3-(1-adamantyl)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 19429711 |
| Molecular Formula | C39H40O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | benzyl 6-[4-(3-acetyloxypropyl)-3-(1-adamantyl)phenyl]naphthalene-2-carboxylate |
| SMILES | CC(=O)OCCCc1ccc(-c2ccc3cc(C(=O)OCc4ccccc4)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C39H40O4/c1-26(40)42-15-5-8-31-9-10-35(21-37(31)39-22-28-16-29(23-39)18-30(17-28)24-39)33-11-12-34-20-36(14-13-32(34)19-33)38(41)43-25-27-6-3-2-4-7-27/h2-4,6-7,9-14,19-21,28-30H,5,8,15-18,22-25H2,1H3 |
| InChIKey | CPIUOQHYFPJATF-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|