C29H28O4 — CID 19598124
4-[7-(1-adamantyl)-6-methoxycarbonylnaphthalen-2-yl]benzoic acid (PubChem CID 19598124) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-[7-(1-adamantyl)-6-methoxycarbonylnaphthalen-2-yl]benzoic acid.
| Compound Name | 4-[7-(1-adamantyl)-6-methoxycarbonylnaphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 19598124 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-[7-(1-adamantyl)-6-methoxycarbonylnaphthalen-2-yl]benzoic acid |
| SMILES | COC(=O)c1cc2ccc(-c3ccc(C(=O)O)cc3)cc2cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H28O4/c1-33-28(32)25-12-23-7-6-22(20-2-4-21(5-3-20)27(30)31)11-24(23)13-26(25)29-14-17-8-18(15-29)10-19(9-17)16-29/h2-7,11-13,17-19H,8-10,14-16H2,1H3,(H,30,31) |
| InChIKey | NVGFTNPFIZEOAW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |