C34H40O4 — CID 70231365
4-[7-(1-adamantyl)-6-(1-methoxyhexoxy)naphthalen-2-yl]benzoic acid (PubChem CID 70231365) has the molecular formula C34H40O4 and a molecular weight of 512.69 g/mol. Its IUPAC name is 4-[7-(1-adamantyl)-6-(1-methoxyhexoxy)naphthalen-2-yl]benzoic acid.
| Compound Name | 4-[7-(1-adamantyl)-6-(1-methoxyhexoxy)naphthalen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 70231365 |
| Molecular Formula | C34H40O4 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 4-[7-(1-adamantyl)-6-(1-methoxyhexoxy)naphthalen-2-yl]benzoic acid |
| SMILES | CCCCCC(OC)Oc1cc2ccc(-c3ccc(C(=O)O)cc3)cc2cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H40O4/c1-3-4-5-6-32(37-2)38-31-18-28-12-11-27(25-7-9-26(10-8-25)33(35)36)16-29(28)17-30(31)34-19-22-13-23(20-34)15-24(14-22)21-34/h7-12,16-18,22-24,32H,3-6,13-15,19-21H2,1-2H3,(H,35,36) |
| InChIKey | PJDWJXVSMFHHJA-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|